C18H21N3O3S2 — CID 2369811
N-[(1S)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide (PubChem CID 2369811) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[(1S)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(1S)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2369811 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[(1S)-1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
| SMILES | C[C@H](NC(=O)CSc1nc2ccc([N+](=O)[O-])cc2s1)[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C18H21N3O3S2/c1-10(14-7-11-2-3-12(14)6-11)19-17(22)9-25-18-20-15-5-4-13(21(23)24)8-16(15)26-18/h4-5,8,10-12,14H,2-3,6-7,9H2,1H3,(H,19,22)/t10-,11+,12-,14+/m0/s1 |
| InChIKey | ILYGSKIESPUXGB-KZVDOYCCSA-N |
| XLogP | 4.24 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|