C19H24N4O3 — CID 98685769
N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(6-nitroindazol-1-yl)propanamide (PubChem CID 98685769) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(6-nitroindazol-1-yl)propanamide.
| Compound Name | N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(6-nitroindazol-1-yl)propanamide |
|---|---|
| PubChem CID | 98685769 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(6-nitroindazol-1-yl)propanamide |
| SMILES | C[C@@H](NC(=O)CCn1ncc2ccc([N+](=O)[O-])cc21)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C19H24N4O3/c1-12(17-9-13-2-3-14(17)8-13)21-19(24)6-7-22-18-10-16(23(25)26)5-4-15(18)11-20-22/h4-5,10-14,17H,2-3,6-9H2,1H3,(H,21,24)/t12-,13+,14+,17+/m1/s1 |
| InChIKey | KJPZOXXJUKMLHR-FHIRATQRSA-N |
| XLogP | 3.28 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|