C15H21ClN4O3 — CID 98272733
N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-chloro-3-nitropyrazol-1-yl)propanamide (PubChem CID 98272733) has the molecular formula C15H21ClN4O3 and a molecular weight of 340.81 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-chloro-3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-chloro-3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 98272733 |
| Molecular Formula | C15H21ClN4O3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[(1S)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-chloro-3-nitropyrazol-1-yl)propanamide |
| SMILES | C[C@H](NC(=O)CCn1cc(Cl)c([N+](=O)[O-])n1)[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C15H21ClN4O3/c1-9(12-7-10-2-3-11(12)6-10)17-14(21)4-5-19-8-13(16)15(18-19)20(22)23/h8-12H,2-7H2,1H3,(H,17,21)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | MNNJQUBAMGPJPY-IRCOFANPSA-N |
| XLogP | 2.78 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|