C35H43N3O3S — CID 140526431
tert-butyl 2-[2-[3-[2,2-diphenylethyl(pentanoyl)amino]propylsulfanyl]benzimidazol-1-yl]acetate (PubChem CID 140526431) has the molecular formula C35H43N3O3S and a molecular weight of 585.81 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-[2,2-diphenylethyl(pentanoyl)amino]propylsulfanyl]benzimidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-[3-[2,2-diphenylethyl(pentanoyl)amino]propylsulfanyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 140526431 |
| Molecular Formula | C35H43N3O3S |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | tert-butyl 2-[2-[3-[2,2-diphenylethyl(pentanoyl)amino]propylsulfanyl]benzimidazol-1-yl]acetate |
| SMILES | CCCCC(=O)N(CCCSc1nc2ccccc2n1CC(=O)OC(C)(C)C)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H43N3O3S/c1-5-6-22-32(39)37(25-29(27-16-9-7-10-17-27)28-18-11-8-12-19-28)23-15-24-42-34-36-30-20-13-14-21-31(30)38(34)26-33(40)41-35(2,3)4/h7-14,16-21,29H,5-6,15,22-26H2,1-4H3 |
| InChIKey | GVRHEFRVOWGYJC-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|