C28H39N3O4S2 — CID 91415654
tert-butyl 2-[2-[3-[butylsulfonyl(2-phenylethyl)amino]propylsulfanyl]benzimidazol-1-yl]acetate (PubChem CID 91415654) has the molecular formula C28H39N3O4S2 and a molecular weight of 545.77 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-[butylsulfonyl(2-phenylethyl)amino]propylsulfanyl]benzimidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-[3-[butylsulfonyl(2-phenylethyl)amino]propylsulfanyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 91415654 |
| Molecular Formula | C28H39N3O4S2 |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | tert-butyl 2-[2-[3-[butylsulfonyl(2-phenylethyl)amino]propylsulfanyl]benzimidazol-1-yl]acetate |
| SMILES | CCCCS(=O)(=O)N(CCCSc1nc2ccccc2n1CC(=O)OC(C)(C)C)CCc1ccccc1 |
| InChI | InChI=1S/C28H39N3O4S2/c1-5-6-21-37(33,34)30(19-17-23-13-8-7-9-14-23)18-12-20-36-27-29-24-15-10-11-16-25(24)31(27)22-26(32)35-28(2,3)4/h7-11,13-16H,5-6,12,17-22H2,1-4H3 |
| InChIKey | FKHXSRUYFSUGQX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|