C28H37N3O3S — CID 69318680
2-[2-[5-(N-butylanilino)-5-oxopentyl]sulfanylbenzimidazol-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 69318680) has the molecular formula C28H37N3O3S and a molecular weight of 495.69 g/mol. Its IUPAC name is 2-[2-[5-(N-butylanilino)-5-oxopentyl]sulfanylbenzimidazol-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[2-[5-(N-butylanilino)-5-oxopentyl]sulfanylbenzimidazol-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 69318680 |
| Molecular Formula | C28H37N3O3S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 2-[2-[5-(N-butylanilino)-5-oxopentyl]sulfanylbenzimidazol-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | CCCCN(C(=O)CCCCSc1nc2ccccc2n1C(C(=O)O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H37N3O3S/c1-5-6-19-30(21-14-8-7-9-15-21)24(32)18-12-13-20-35-27-29-22-16-10-11-17-23(22)31(27)25(26(33)34)28(2,3)4/h7-11,14-17,25H,5-6,12-13,18-20H2,1-4H3,(H,33,34) |
| InChIKey | NIEQZQDLFCXWCU-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|