C21H23IN2O3S — CID 69316559
2-[6-iodo-2-(2-phenoxyethylsulfanyl)benzimidazol-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 69316559) has the molecular formula C21H23IN2O3S and a molecular weight of 510.40 g/mol. Its IUPAC name is 2-[6-iodo-2-(2-phenoxyethylsulfanyl)benzimidazol-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[6-iodo-2-(2-phenoxyethylsulfanyl)benzimidazol-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 69316559 |
| Molecular Formula | C21H23IN2O3S |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 2-[6-iodo-2-(2-phenoxyethylsulfanyl)benzimidazol-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)n1c(SCCOc2ccccc2)nc2ccc(I)cc21 |
| InChI | InChI=1S/C21H23IN2O3S/c1-21(2,3)18(19(25)26)24-17-13-14(22)9-10-16(17)23-20(24)28-12-11-27-15-7-5-4-6-8-15/h4-10,13,18H,11-12H2,1-3H3,(H,25,26) |
| InChIKey | NIPOCUXXBWLCTR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|