C27H33N3O3S — CID 69315670
2-[2-[3-[(2-cyclopropyl-2-phenylacetyl)amino]propylsulfanyl]benzimidazol-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 69315670) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is 2-[2-[3-[(2-cyclopropyl-2-phenylacetyl)amino]propylsulfanyl]benzimidazol-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[2-[3-[(2-cyclopropyl-2-phenylacetyl)amino]propylsulfanyl]benzimidazol-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 69315670 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[2-[3-[(2-cyclopropyl-2-phenylacetyl)amino]propylsulfanyl]benzimidazol-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)n1c(SCCCNC(=O)C(c2ccccc2)C2CC2)nc2ccccc21 |
| InChI | InChI=1S/C27H33N3O3S/c1-27(2,3)23(25(32)33)30-21-13-8-7-12-20(21)29-26(30)34-17-9-16-28-24(31)22(19-14-15-19)18-10-5-4-6-11-18/h4-8,10-13,19,22-23H,9,14-17H2,1-3H3,(H,28,31)(H,32,33) |
| InChIKey | DPYMCIBWAQAJLE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|