C22H25N3O4S2 — CID 69464939
2-[2-[3-[[cyclopropyl(phenyl)methyl]sulfonylamino]propylsulfanyl]benzimidazol-1-yl]acetic acid (PubChem CID 69464939) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-[2-[3-[[cyclopropyl(phenyl)methyl]sulfonylamino]propylsulfanyl]benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-[3-[[cyclopropyl(phenyl)methyl]sulfonylamino]propylsulfanyl]benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 69464939 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 2-[2-[3-[[cyclopropyl(phenyl)methyl]sulfonylamino]propylsulfanyl]benzimidazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(SCCCNS(=O)(=O)C(c2ccccc2)C2CC2)nc2ccccc21 |
| InChI | InChI=1S/C22H25N3O4S2/c26-20(27)15-25-19-10-5-4-9-18(19)24-22(25)30-14-6-13-23-31(28,29)21(17-11-12-17)16-7-2-1-3-8-16/h1-5,7-10,17,21,23H,6,11-15H2,(H,26,27) |
| InChIKey | QSHAKYVXZBALGV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|