C19H21N3O2S — CID 69315494
2-[2-[3-(benzylamino)propylsulfanyl]benzimidazol-1-yl]acetic acid (PubChem CID 69315494) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[2-[3-(benzylamino)propylsulfanyl]benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-[3-(benzylamino)propylsulfanyl]benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 69315494 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[2-[3-(benzylamino)propylsulfanyl]benzimidazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(SCCCNCc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C19H21N3O2S/c23-18(24)14-22-17-10-5-4-9-16(17)21-19(22)25-12-6-11-20-13-15-7-2-1-3-8-15/h1-5,7-10,20H,6,11-14H2,(H,23,24) |
| InChIKey | BNBUJHODZQNSSI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|