C23H33N3O4S — CID 11676713
2-[2-[3-[butoxycarbonyl(cyclohexyl)amino]propylsulfanyl]benzimidazol-1-yl]acetic acid (PubChem CID 11676713) has the molecular formula C23H33N3O4S and a molecular weight of 447.60 g/mol. Its IUPAC name is 2-[2-[3-[butoxycarbonyl(cyclohexyl)amino]propylsulfanyl]benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-[3-[butoxycarbonyl(cyclohexyl)amino]propylsulfanyl]benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 11676713 |
| Molecular Formula | C23H33N3O4S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[2-[3-[butoxycarbonyl(cyclohexyl)amino]propylsulfanyl]benzimidazol-1-yl]acetic acid |
| SMILES | CCCCOC(=O)N(CCCSc1nc2ccccc2n1CC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C23H33N3O4S/c1-2-3-15-30-23(29)25(18-10-5-4-6-11-18)14-9-16-31-22-24-19-12-7-8-13-20(19)26(22)17-21(27)28/h7-8,12-13,18H,2-6,9-11,14-17H2,1H3,(H,27,28) |
| InChIKey | GWAXPAHWJAYURN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|