C30H33N3O3S — CID 69319601
3,3-dimethyl-2-[2-[3-(N-(2-phenylacetyl)anilino)propylsulfanyl]benzimidazol-1-yl]butanoic acid (PubChem CID 69319601) has the molecular formula C30H33N3O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is 3,3-dimethyl-2-[2-[3-(N-(2-phenylacetyl)anilino)propylsulfanyl]benzimidazol-1-yl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[2-[3-(N-(2-phenylacetyl)anilino)propylsulfanyl]benzimidazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 69319601 |
| Molecular Formula | C30H33N3O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 3,3-dimethyl-2-[2-[3-(N-(2-phenylacetyl)anilino)propylsulfanyl]benzimidazol-1-yl]butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)n1c(SCCCN(C(=O)Cc2ccccc2)c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C30H33N3O3S/c1-30(2,3)27(28(35)36)33-25-18-11-10-17-24(25)31-29(33)37-20-12-19-32(23-15-8-5-9-16-23)26(34)21-22-13-6-4-7-14-22/h4-11,13-18,27H,12,19-21H2,1-3H3,(H,35,36) |
| InChIKey | NKPYHVMIWYSADA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|