C22H24ClN3O — CID 110309383
2-(4-chlorophenyl)-2-cyclopropyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]acetamide (PubChem CID 110309383) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-cyclopropyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-2-cyclopropyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 110309383 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(4-chlorophenyl)-2-cyclopropyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]acetamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)C(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C22H24ClN3O/c1-15-25-19-5-2-3-6-20(19)26(15)14-4-13-24-22(27)21(16-7-8-16)17-9-11-18(23)12-10-17/h2-3,5-6,9-12,16,21H,4,7-8,13-14H2,1H3,(H,24,27) |
| InChIKey | OYEXPLZGTVLZSL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|