C29H38N4O6S — CID 69314457
2-[2-[3-[butoxycarbonyl(2-phenylethyl)amino]propylsulfanyl]-5-nitrobenzimidazol-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 69314457) has the molecular formula C29H38N4O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is 2-[2-[3-[butoxycarbonyl(2-phenylethyl)amino]propylsulfanyl]-5-nitrobenzimidazol-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[2-[3-[butoxycarbonyl(2-phenylethyl)amino]propylsulfanyl]-5-nitrobenzimidazol-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 69314457 |
| Molecular Formula | C29H38N4O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 2-[2-[3-[butoxycarbonyl(2-phenylethyl)amino]propylsulfanyl]-5-nitrobenzimidazol-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | CCCCOC(=O)N(CCCSc1nc2cc([N+](=O)[O-])ccc2n1C(C(=O)O)C(C)(C)C)CCc1ccccc1 |
| InChI | InChI=1S/C29H38N4O6S/c1-5-6-18-39-28(36)31(17-15-21-11-8-7-9-12-21)16-10-19-40-27-30-23-20-22(33(37)38)13-14-24(23)32(27)25(26(34)35)29(2,3)4/h7-9,11-14,20,25H,5-6,10,15-19H2,1-4H3,(H,34,35) |
| InChIKey | KTKITVPNPDPWAU-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|