C13H15N3O4S — CID 140526433
tert-butyl 2-(5-nitro-2-sulfanylidene-3H-benzimidazol-1-yl)acetate (PubChem CID 140526433) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is tert-butyl 2-(5-nitro-2-sulfanylidene-3H-benzimidazol-1-yl)acetate.
| Compound Name | tert-butyl 2-(5-nitro-2-sulfanylidene-3H-benzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 140526433 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | tert-butyl 2-(5-nitro-2-sulfanylidene-3H-benzimidazol-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(=S)[nH]c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C13H15N3O4S/c1-13(2,3)20-11(17)7-15-10-5-4-8(16(18)19)6-9(10)14-12(15)21/h4-6H,7H2,1-3H3,(H,14,21) |
| InChIKey | MMFSSQGINSTVBV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|