C17H20N2O3S — CID 42805882
ethyl 4-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylbutanoate (PubChem CID 42805882) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is ethyl 4-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylbutanoate.
| Compound Name | ethyl 4-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylbutanoate |
|---|---|
| PubChem CID | 42805882 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | ethyl 4-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylbutanoate |
| SMILES | CCOC(=O)CCCSc1nc2ccccc2c(=O)n1C1CC1 |
| InChI | InChI=1S/C17H20N2O3S/c1-2-22-15(20)8-5-11-23-17-18-14-7-4-3-6-13(14)16(21)19(17)12-9-10-12/h3-4,6-7,12H,2,5,8-11H2,1H3 |
| InChIKey | TWHAMHUNWJONOS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|