C21H22N2O2S — CID 8979700
3-cyclopropyl-2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]quinazolin-4-one (PubChem CID 8979700) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 3-cyclopropyl-2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]quinazolin-4-one.
| Compound Name | 3-cyclopropyl-2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 8979700 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-cyclopropyl-2-[2-(3,5-dimethylphenoxy)ethylsulfanyl]quinazolin-4-one |
| SMILES | Cc1cc(C)cc(OCCSc2nc3ccccc3c(=O)n2C2CC2)c1 |
| InChI | InChI=1S/C21H22N2O2S/c1-14-11-15(2)13-17(12-14)25-9-10-26-21-22-19-6-4-3-5-18(19)20(24)23(21)16-7-8-16/h3-6,11-13,16H,7-10H2,1-2H3 |
| InChIKey | ITEQAPYEIDPCMI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|