C16H20N2OS — CID 154830982
3-(4-methylcyclohexyl)-2-methylsulfanylquinazolin-4-one (PubChem CID 154830982) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-(4-methylcyclohexyl)-2-methylsulfanylquinazolin-4-one.
| Compound Name | 3-(4-methylcyclohexyl)-2-methylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 154830982 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3-(4-methylcyclohexyl)-2-methylsulfanylquinazolin-4-one |
| SMILES | CSc1nc2ccccc2c(=O)n1C1CCC(C)CC1 |
| InChI | InChI=1S/C16H20N2OS/c1-11-7-9-12(10-8-11)18-15(19)13-5-3-4-6-14(13)17-16(18)20-2/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | KYCDQHKWXBPFCK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |