C18H22N2O3S — CID 42805883
ethyl 2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylpentanoate (PubChem CID 42805883) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is ethyl 2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylpentanoate.
| Compound Name | ethyl 2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylpentanoate |
|---|---|
| PubChem CID | 42805883 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | ethyl 2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylpentanoate |
| SMILES | CCCC(Sc1nc2ccccc2c(=O)n1C1CC1)C(=O)OCC |
| InChI | InChI=1S/C18H22N2O3S/c1-3-7-15(17(22)23-4-2)24-18-19-14-9-6-5-8-13(14)16(21)20(18)12-10-11-12/h5-6,8-9,12,15H,3-4,7,10-11H2,1-2H3 |
| InChIKey | LSPUFDSGXRLFLV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |