C22H21N3O2S — CID 41380345
4-[2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylethoxy]benzonitrile (PubChem CID 41380345) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-[2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylethoxy]benzonitrile.
| Compound Name | 4-[2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylethoxy]benzonitrile |
|---|---|
| PubChem CID | 41380345 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCSc2nc3ccccc3c(=O)n2C2CCCC2)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c23-15-16-9-11-18(12-10-16)27-13-14-28-22-24-20-8-4-3-7-19(20)21(26)25(22)17-5-1-2-6-17/h3-4,7-12,17H,1-2,5-6,13-14H2 |
| InChIKey | NOEANQJJBOTDER-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|