C18H17ClN4OS — CID 7005933
N'-[1-(2-chlorophenyl)ethenyl]-2-(1-methylbenzimidazol-2-yl)sulfanylacetohydrazide (PubChem CID 7005933) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is N'-[1-(2-chlorophenyl)ethenyl]-2-(1-methylbenzimidazol-2-yl)sulfanylacetohydrazide.
| Compound Name | N'-[1-(2-chlorophenyl)ethenyl]-2-(1-methylbenzimidazol-2-yl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 7005933 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N'-[1-(2-chlorophenyl)ethenyl]-2-(1-methylbenzimidazol-2-yl)sulfanylacetohydrazide |
| SMILES | C=C(NNC(=O)CSc1nc2ccccc2n1C)c1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN4OS/c1-12(13-7-3-4-8-14(13)19)21-22-17(24)11-25-18-20-15-9-5-6-10-16(15)23(18)2/h3-10,21H,1,11H2,2H3,(H,22,24) |
| InChIKey | GYOMHGUEWNAZMA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|