C23H31N3O6 — CID 55308605
ethyl 4-[[2-[3-(4-butyl-3-oxoquinoxalin-2-yl)propanoyloxy]acetyl]amino]butanoate (PubChem CID 55308605) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is ethyl 4-[[2-[3-(4-butyl-3-oxoquinoxalin-2-yl)propanoyloxy]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[3-(4-butyl-3-oxoquinoxalin-2-yl)propanoyloxy]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 55308605 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | ethyl 4-[[2-[3-(4-butyl-3-oxoquinoxalin-2-yl)propanoyloxy]acetyl]amino]butanoate |
| SMILES | CCCCn1c(=O)c(CCC(=O)OCC(=O)NCCCC(=O)OCC)nc2ccccc21 |
| InChI | InChI=1S/C23H31N3O6/c1-3-5-15-26-19-10-7-6-9-17(19)25-18(23(26)30)12-13-22(29)32-16-20(27)24-14-8-11-21(28)31-4-2/h6-7,9-10H,3-5,8,11-16H2,1-2H3,(H,24,27) |
| InChIKey | PVEVOVKEAWCOMJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|