C11H14N2O3S — CID 54979960
ethyl 2-(4-amino-3-carbamoylphenyl)sulfanylacetate (PubChem CID 54979960) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is ethyl 2-(4-amino-3-carbamoylphenyl)sulfanylacetate.
| Compound Name | ethyl 2-(4-amino-3-carbamoylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 54979960 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | ethyl 2-(4-amino-3-carbamoylphenyl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1ccc(N)c(C(N)=O)c1 |
| InChI | InChI=1S/C11H14N2O3S/c1-2-16-10(14)6-17-7-3-4-9(12)8(5-7)11(13)15/h3-5H,2,6,12H2,1H3,(H2,13,15) |
| InChIKey | XFIDPRJVJGNHFM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|