C11H13ClN2O3S — CID 107198568
ethyl 2-(4-amino-2-carbamoyl-6-chlorophenyl)sulfanylacetate (PubChem CID 107198568) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is ethyl 2-(4-amino-2-carbamoyl-6-chlorophenyl)sulfanylacetate.
| Compound Name | ethyl 2-(4-amino-2-carbamoyl-6-chlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 107198568 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | ethyl 2-(4-amino-2-carbamoyl-6-chlorophenyl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1c(Cl)cc(N)cc1C(N)=O |
| InChI | InChI=1S/C11H13ClN2O3S/c1-2-17-9(15)5-18-10-7(11(14)16)3-6(13)4-8(10)12/h3-4H,2,5,13H2,1H3,(H2,14,16) |
| InChIKey | MZRSDBKZVJMMHB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|