C10H11F2NO2S — CID 62531329
ethyl 2-(6-amino-2,3-difluorophenyl)sulfanylacetate (PubChem CID 62531329) has the molecular formula C10H11F2NO2S and a molecular weight of 247.27 g/mol. Its IUPAC name is ethyl 2-(6-amino-2,3-difluorophenyl)sulfanylacetate.
| Compound Name | ethyl 2-(6-amino-2,3-difluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 62531329 |
| Molecular Formula | C10H11F2NO2S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | ethyl 2-(6-amino-2,3-difluorophenyl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C10H11F2NO2S/c1-2-15-8(14)5-16-10-7(13)4-3-6(11)9(10)12/h3-4H,2,5,13H2,1H3 |
| InChIKey | KMGFHOXIGQCXLC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|