C11H12Cl3N3O2 — CID 8771652
N-methyl-2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]acetamide (PubChem CID 8771652) has the molecular formula C11H12Cl3N3O2 and a molecular weight of 324.60 g/mol. Its IUPAC name is N-methyl-2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]acetamide.
| Compound Name | N-methyl-2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 8771652 |
| Molecular Formula | C11H12Cl3N3O2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | N-methyl-2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]acetamide |
| SMILES | CNC(=O)CNCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3N3O2/c1-15-10(18)4-16-5-11(19)17-9-3-7(13)6(12)2-8(9)14/h2-3,16H,4-5H2,1H3,(H,15,18)(H,17,19) |
| InChIKey | DNHDLQAQWOTBCD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|