C18H18Cl3N3O2 — CID 54830533
2-methyl-N-[4-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]phenyl]propanamide (PubChem CID 54830533) has the molecular formula C18H18Cl3N3O2 and a molecular weight of 414.72 g/mol. Its IUPAC name is 2-methyl-N-[4-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54830533 |
| Molecular Formula | C18H18Cl3N3O2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-methyl-N-[4-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(NCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl3N3O2/c1-10(2)18(26)23-12-5-3-11(4-6-12)22-9-17(25)24-16-8-14(20)13(19)7-15(16)21/h3-8,10,22H,9H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | ZGFHNKRHFXBGSQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|