C18H19Cl2N3O2 — CID 54819782
N-[4-[[2-(2,5-dichloroanilino)acetyl]amino]phenyl]-2-methylpropanamide (PubChem CID 54819782) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is N-[4-[[2-(2,5-dichloroanilino)acetyl]amino]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[2-(2,5-dichloroanilino)acetyl]amino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 54819782 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[4-[[2-(2,5-dichloroanilino)acetyl]amino]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(NC(=O)CNc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-11(2)18(25)23-14-6-4-13(5-7-14)22-17(24)10-21-16-9-12(19)3-8-15(16)20/h3-9,11,21H,10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | NRSIXLQMNMJYDZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |