C18H18Cl2N2O2 — CID 54819813
2-(2,5-dichloroanilino)-N-[4-(2-methylprop-2-enoxy)phenyl]acetamide (PubChem CID 54819813) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 2-(2,5-dichloroanilino)-N-[4-(2-methylprop-2-enoxy)phenyl]acetamide.
| Compound Name | 2-(2,5-dichloroanilino)-N-[4-(2-methylprop-2-enoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54819813 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-(2,5-dichloroanilino)-N-[4-(2-methylprop-2-enoxy)phenyl]acetamide |
| SMILES | C=C(C)COc1ccc(NC(=O)CNc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-12(2)11-24-15-6-4-14(5-7-15)22-18(23)10-21-17-9-13(19)3-8-16(17)20/h3-9,21H,1,10-11H2,2H3,(H,22,23) |
| InChIKey | HVYSDAOORIVQCM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|