C15H11Cl2N3O — CID 26416996
N-(4-cyanophenyl)-2-(2,5-dichloroanilino)acetamide (PubChem CID 26416996) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(2,5-dichloroanilino)acetamide.
| Compound Name | N-(4-cyanophenyl)-2-(2,5-dichloroanilino)acetamide |
|---|---|
| PubChem CID | 26416996 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-(4-cyanophenyl)-2-(2,5-dichloroanilino)acetamide |
| SMILES | N#Cc1ccc(NC(=O)CNc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H11Cl2N3O/c16-11-3-6-13(17)14(7-11)19-9-15(21)20-12-4-1-10(8-18)2-5-12/h1-7,19H,9H2,(H,20,21) |
| InChIKey | YAVJPELWOIPIRN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |