C18H19Cl3N2O2 — CID 54816614
N-[4-(2-methylpropoxy)phenyl]-2-(2,4,5-trichloroanilino)acetamide (PubChem CID 54816614) has the molecular formula C18H19Cl3N2O2 and a molecular weight of 401.72 g/mol. Its IUPAC name is N-[4-(2-methylpropoxy)phenyl]-2-(2,4,5-trichloroanilino)acetamide.
| Compound Name | N-[4-(2-methylpropoxy)phenyl]-2-(2,4,5-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 54816614 |
| Molecular Formula | C18H19Cl3N2O2 |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | N-[4-(2-methylpropoxy)phenyl]-2-(2,4,5-trichloroanilino)acetamide |
| SMILES | CC(C)COc1ccc(NC(=O)CNc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl3N2O2/c1-11(2)10-25-13-5-3-12(4-6-13)23-18(24)9-22-17-8-15(20)14(19)7-16(17)21/h3-8,11,22H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | LREYSPJIWIYHSH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|