C17H15Cl3N2O2 — CID 54816702
N-(4-prop-2-enoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide (PubChem CID 54816702) has the molecular formula C17H15Cl3N2O2 and a molecular weight of 385.68 g/mol. Its IUPAC name is N-(4-prop-2-enoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide.
| Compound Name | N-(4-prop-2-enoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 54816702 |
| Molecular Formula | C17H15Cl3N2O2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | N-(4-prop-2-enoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide |
| SMILES | C=CCOc1ccc(NC(=O)CNc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl3N2O2/c1-2-7-24-12-5-3-11(4-6-12)22-17(23)10-21-16-9-14(19)13(18)8-15(16)20/h2-6,8-9,21H,1,7,10H2,(H,22,23) |
| InChIKey | NVCZYDSSKDSDTP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|