C18H22N4O6 — CID 7800169
N-(furan-2-ylmethylcarbamoyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 7800169) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamoyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(furan-2-ylmethylcarbamoyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7800169 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-(furan-2-ylmethylcarbamoyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1N1C(=O)C(=O)N(CC(=O)NC(=O)NCc2ccco2)C1=O |
| InChI | InChI=1S/C18H22N4O6/c1-11-5-2-3-7-13(11)22-16(25)15(24)21(18(22)27)10-14(23)20-17(26)19-9-12-6-4-8-28-12/h4,6,8,11,13H,2-3,5,7,9-10H2,1H3,(H2,19,20,23,26)/t11-,13-/m1/s1 |
| InChIKey | KRMJKXAEDMINML-DGCLKSJQSA-N |
| XLogP | 0.97 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|