C17H15ClN4O4 — CID 2660736
N-(5-chloro-2-cyanophenyl)-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 2660736) has the molecular formula C17H15ClN4O4 and a molecular weight of 374.78 g/mol. Its IUPAC name is N-(5-chloro-2-cyanophenyl)-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-cyanophenyl)-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 2660736 |
| Molecular Formula | C17H15ClN4O4 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-(5-chloro-2-cyanophenyl)-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)CN1C(=O)C(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C17H15ClN4O4/c18-11-6-5-10(8-19)13(7-11)20-14(23)9-21-15(24)16(25)22(17(21)26)12-3-1-2-4-12/h5-7,12H,1-4,9H2,(H,20,23) |
| InChIKey | UWGAVVVRFSCLPQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|