C23H21N3O5 — CID 7756202
N-(2-benzoylphenyl)-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 7756202) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(2-benzoylphenyl)-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7756202 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-(2-benzoylphenyl)-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(C2CCCC2)C1=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O5/c27-19(14-25-21(29)22(30)26(23(25)31)16-10-4-5-11-16)24-18-13-7-6-12-17(18)20(28)15-8-2-1-3-9-15/h1-3,6-9,12-13,16H,4-5,10-11,14H2,(H,24,27) |
| InChIKey | PJHIXOPIRROFAY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|