C20H17N3O5 — CID 39920760
2-(3-cyclopropyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2-phenoxyphenyl)acetamide (PubChem CID 39920760) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is 2-(3-cyclopropyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2-phenoxyphenyl)acetamide.
| Compound Name | 2-(3-cyclopropyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39920760 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-(3-cyclopropyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2-phenoxyphenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(C2CC2)C1=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C20H17N3O5/c24-17(12-22-18(25)19(26)23(20(22)27)13-10-11-13)21-15-8-4-5-9-16(15)28-14-6-2-1-3-7-14/h1-9,13H,10-12H2,(H,21,24) |
| InChIKey | YNNXPDHHUADYAV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|