C22H20N2O4 — CID 7952314
2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-phenoxyphenyl)acetamide (PubChem CID 7952314) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-phenoxyphenyl)acetamide.
| Compound Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7952314 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-phenoxyphenyl)acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CC=CC[C@@H]2C1=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C22H20N2O4/c25-20(14-24-21(26)16-10-4-5-11-17(16)22(24)27)23-18-12-6-7-13-19(18)28-15-8-2-1-3-9-15/h1-9,12-13,16-17H,10-11,14H2,(H,23,25)/t16-,17-/m0/s1 |
| InChIKey | URJKOIZCZDJZJM-IRXDYDNUSA-N |
| XLogP | 3.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|