C24H25N3O6 — CID 4880290
2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[4-(4-ethoxyphenoxy)phenyl]acetamide (PubChem CID 4880290) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[4-(4-ethoxyphenoxy)phenyl]acetamide.
| Compound Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[4-(4-ethoxyphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 4880290 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[4-(4-ethoxyphenoxy)phenyl]acetamide |
| SMILES | CCOc1ccc(Oc2ccc(NC(=O)CN3C(=O)C(=O)N(C4CCCC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O6/c1-2-32-18-11-13-20(14-12-18)33-19-9-7-16(8-10-19)25-21(28)15-26-22(29)23(30)27(24(26)31)17-5-3-4-6-17/h7-14,17H,2-6,15H2,1H3,(H,25,28) |
| InChIKey | NGGBYBPVUHVULF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|