C19H28N4O3S — CID 8681921
2-[methyl-[[(2R)-oxolan-2-yl]methylcarbamothioyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 8681921) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[methyl-[[(2R)-oxolan-2-yl]methylcarbamothioyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[methyl-[[(2R)-oxolan-2-yl]methylcarbamothioyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 8681921 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[methyl-[[(2R)-oxolan-2-yl]methylcarbamothioyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=S)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C19H28N4O3S/c1-22(19(27)20-13-17-3-2-10-26-17)14-18(24)21-15-4-6-16(7-5-15)23-8-11-25-12-9-23/h4-7,17H,2-3,8-14H2,1H3,(H,20,27)(H,21,24)/t17-/m1/s1 |
| InChIKey | PBSPRCSBRYEEQN-QGZVFWFLSA-N |
| XLogP | 1.45 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|