C11H15N5O — CID 107811889
3-[(N-amino-N'-cyclopropylcarbamimidoyl)amino]benzamide (PubChem CID 107811889) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 3-[(N-amino-N'-cyclopropylcarbamimidoyl)amino]benzamide.
| Compound Name | 3-[(N-amino-N'-cyclopropylcarbamimidoyl)amino]benzamide |
|---|---|
| PubChem CID | 107811889 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3-[(N-amino-N'-cyclopropylcarbamimidoyl)amino]benzamide |
| SMILES | NN/C(=N\C1CC1)Nc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C11H15N5O/c12-10(17)7-2-1-3-9(6-7)15-11(16-13)14-8-4-5-8/h1-3,6,8H,4-5,13H2,(H2,12,17)(H2,14,15,16) |
| InChIKey | RJYGCAWZPOQJJH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|