C11H13N5S — CID 114003331
1-amino-3-(1,3-benzothiazol-6-yl)-2-cyclopropylguanidine (PubChem CID 114003331) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is 1-amino-3-(1,3-benzothiazol-6-yl)-2-cyclopropylguanidine.
| Compound Name | 1-amino-3-(1,3-benzothiazol-6-yl)-2-cyclopropylguanidine |
|---|---|
| PubChem CID | 114003331 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1-amino-3-(1,3-benzothiazol-6-yl)-2-cyclopropylguanidine |
| SMILES | NN/C(=N\C1CC1)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H13N5S/c12-16-11(14-7-1-2-7)15-8-3-4-9-10(5-8)17-6-13-9/h3-7H,1-2,12H2,(H2,14,15,16) |
| InChIKey | KXEKLYNTZDMJQV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|