C14H19N3S — CID 59230547
N-[(4-aminocyclohexyl)methyl]-1,3-benzothiazol-6-amine (PubChem CID 59230547) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 59230547 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-1,3-benzothiazol-6-amine |
| SMILES | NC1CCC(CNc2ccc3ncsc3c2)CC1 |
| InChI | InChI=1S/C14H19N3S/c15-11-3-1-10(2-4-11)8-16-12-5-6-13-14(7-12)18-9-17-13/h5-7,9-11,16H,1-4,8,15H2 |
| InChIKey | WZDVWKPUJDECEK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |