C23H22Cl3N5O — CID 118470760
5-(4-chlorophenyl)-N'-cyclopropyl-1-(2,4-dichlorophenyl)-N-morpholin-4-ylpyrazole-3-carboximidamide (PubChem CID 118470760) has the molecular formula C23H22Cl3N5O and a molecular weight of 490.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-cyclopropyl-1-(2,4-dichlorophenyl)-N-morpholin-4-ylpyrazole-3-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-cyclopropyl-1-(2,4-dichlorophenyl)-N-morpholin-4-ylpyrazole-3-carboximidamide |
|---|---|
| PubChem CID | 118470760 |
| Molecular Formula | C23H22Cl3N5O |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-cyclopropyl-1-(2,4-dichlorophenyl)-N-morpholin-4-ylpyrazole-3-carboximidamide |
| SMILES | Clc1ccc(-c2cc(/C(=N\C3CC3)NN3CCOCC3)nn2-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H22Cl3N5O/c24-16-3-1-15(2-4-16)22-14-20(28-31(22)21-8-5-17(25)13-19(21)26)23(27-18-6-7-18)29-30-9-11-32-12-10-30/h1-5,8,13-14,18H,6-7,9-12H2,(H,27,29) |
| InChIKey | SZMYWBBWAILPTI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|