C22H19Cl3N6O — CID 118470625
(2S)-2-[[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)pyrazol-3-yl]-(cyanoamino)methylidene]amino]-3-methylbutanamide (PubChem CID 118470625) has the molecular formula C22H19Cl3N6O and a molecular weight of 489.79 g/mol. Its IUPAC name is (2S)-2-[[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)pyrazol-3-yl]-(cyanoamino)methylidene]amino]-3-methylbutanamide.
| Compound Name | (2S)-2-[[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)pyrazol-3-yl]-(cyanoamino)methylidene]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 118470625 |
| Molecular Formula | C22H19Cl3N6O |
| Molecular Weight | 489.79 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | (2S)-2-[[[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)pyrazol-3-yl]-(cyanoamino)methylidene]amino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](/N=C(\NC#N)c1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2Cl)n1)C(N)=O |
| InChI | InChI=1S/C22H19Cl3N6O/c1-12(2)20(21(27)32)29-22(28-11-26)17-10-19(13-3-5-14(23)6-4-13)31(30-17)18-8-7-15(24)9-16(18)25/h3-10,12,20H,1-2H3,(H2,27,32)(H,28,29)/t20-/m0/s1 |
| InChIKey | PJOCPSGHCKMDHE-FQEVSTJZSA-N |
| XLogP | 4.83 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|