C23H22Cl3N5O2S — CID 118470623
5-(4-chlorophenyl)-N'-cyclopropyl-1-(2,4-dichlorophenyl)-N-(1,1-dioxo-1,4-thiazinan-4-yl)pyrazole-3-carboximidamide (PubChem CID 118470623) has the molecular formula C23H22Cl3N5O2S and a molecular weight of 538.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-cyclopropyl-1-(2,4-dichlorophenyl)-N-(1,1-dioxo-1,4-thiazinan-4-yl)pyrazole-3-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-cyclopropyl-1-(2,4-dichlorophenyl)-N-(1,1-dioxo-1,4-thiazinan-4-yl)pyrazole-3-carboximidamide |
|---|---|
| PubChem CID | 118470623 |
| Molecular Formula | C23H22Cl3N5O2S |
| Molecular Weight | 538.89 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-cyclopropyl-1-(2,4-dichlorophenyl)-N-(1,1-dioxo-1,4-thiazinan-4-yl)pyrazole-3-carboximidamide |
| SMILES | O=S1(=O)CCN(N/C(=N/C2CC2)c2cc(-c3ccc(Cl)cc3)n(-c3ccc(Cl)cc3Cl)n2)CC1 |
| InChI | InChI=1S/C23H22Cl3N5O2S/c24-16-3-1-15(2-4-16)22-14-20(28-31(22)21-8-5-17(25)13-19(21)26)23(27-18-6-7-18)29-30-9-11-34(32,33)12-10-30/h1-5,8,13-14,18H,6-7,9-12H2,(H,27,29) |
| InChIKey | OKGZWCPWGFTWLC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|