C23H31N7O2 — CID 27162469
1-cyclohexyl-3-[4-(cyclohexylcarbamoylamino)-6-phenyl-1,3,5-triazin-2-yl]urea (PubChem CID 27162469) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(cyclohexylcarbamoylamino)-6-phenyl-1,3,5-triazin-2-yl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(cyclohexylcarbamoylamino)-6-phenyl-1,3,5-triazin-2-yl]urea |
|---|---|
| PubChem CID | 27162469 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-cyclohexyl-3-[4-(cyclohexylcarbamoylamino)-6-phenyl-1,3,5-triazin-2-yl]urea |
| SMILES | O=C(Nc1nc(NC(=O)NC2CCCCC2)nc(-c2ccccc2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C23H31N7O2/c31-22(24-17-12-6-2-7-13-17)29-20-26-19(16-10-4-1-5-11-16)27-21(28-20)30-23(32)25-18-14-8-3-9-15-18/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2,(H4,24,25,26,27,28,29,30,31,32) |
| InChIKey | VQRBTKIMIGSOCN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |