C23H28N8O — CID 90949063
1-cyclopentyl-3-[2-(N-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 90949063) has the molecular formula C23H28N8O and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(N-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-cyclopentyl-3-[2-(N-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 90949063 |
| Molecular Formula | C23H28N8O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 1-cyclopentyl-3-[2-(N-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | O=C(Nc1ccc2cnc(N(c3ccccc3)N3CCNCC3)nc2n1)NC1CCCC1 |
| InChI | InChI=1S/C23H28N8O/c32-23(26-18-6-4-5-7-18)28-20-11-10-17-16-25-22(29-21(17)27-20)31(19-8-2-1-3-9-19)30-14-12-24-13-15-30/h1-3,8-11,16,18,24H,4-7,12-15H2,(H2,25,26,27,28,29,32) |
| InChIKey | HLWUXOJSSMRXII-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |