C34H45N7O2Si — CID 171547006
6-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-8-(1,3-oxazol-5-ylmethyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171547006) has the molecular formula C34H45N7O2Si and a molecular weight of 611.87 g/mol. Its IUPAC name is 6-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-8-(1,3-oxazol-5-ylmethyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-8-(1,3-oxazol-5-ylmethyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171547006 |
| Molecular Formula | C34H45N7O2Si |
| Molecular Weight | 611.87 g/mol |
| Exact Mass | 611.34 |
| IUPAC Name | 6-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-8-(1,3-oxazol-5-ylmethyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2n(Cc2cnco2)c1=O |
| InChI | InChI=1S/C34H45N7O2Si/c1-23(2)44(24(3)4,25(5)6)18-13-30-26(7)33(42)41(21-29-19-35-22-43-29)32-31(30)20-36-34(38-32)37-27-9-11-28(12-10-27)40-16-14-39(8)15-17-40/h9-12,19-20,22-25H,14-17,21H2,1-8H3,(H,36,37,38) |
| InChIKey | SRFFLFGGWHDKHS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.87 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|