C20H24ClN5O — CID 52995635
2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-methylquinazolin-4-amine;hydrochloride (PubChem CID 52995635) has the molecular formula C20H24ClN5O and a molecular weight of 385.90 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-methylquinazolin-4-amine;hydrochloride.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-methylquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 52995635 |
| Molecular Formula | C20H24ClN5O |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-methylquinazolin-4-amine;hydrochloride |
| SMILES | CNc1nc(N2CCN(c3ccc(OC)cc3)CC2)nc2ccccc12.Cl |
| InChI | InChI=1S/C20H23N5O.ClH/c1-21-19-17-5-3-4-6-18(17)22-20(23-19)25-13-11-24(12-14-25)15-7-9-16(26-2)10-8-15;/h3-10H,11-14H2,1-2H3,(H,21,22,23);1H |
| InChIKey | TZYLIYMAGJVOCW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|