C22H25N5O3 — CID 71691224
ethyl 4-[4-(4-methoxyanilino)quinazolin-2-yl]piperazine-1-carboxylate (PubChem CID 71691224) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl 4-[4-(4-methoxyanilino)quinazolin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(4-methoxyanilino)quinazolin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71691224 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | ethyl 4-[4-(4-methoxyanilino)quinazolin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc(Nc3ccc(OC)cc3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C22H25N5O3/c1-3-30-22(28)27-14-12-26(13-15-27)21-24-19-7-5-4-6-18(19)20(25-21)23-16-8-10-17(29-2)11-9-16/h4-11H,3,12-15H2,1-2H3,(H,23,24,25) |
| InChIKey | VQZUBIYYSJRVEW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |